cas: 5825-62-7 — see every product listed under this CAS number, including other names
N-(4-Nitrophenyl)methanesulfonamide, 95% (CAS 5825-62-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329754-1G |
| cas | 5825-62-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 544.62 Pln | |
| Fluorochem | 100g | 1325.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-(4-nitrophenyl)methanesulfonamide (CAS 5825-62-7) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: N-(4-nitrophenyl)methanesulfonamide. InChIKey: AXEHDVUAWILBRN-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | N-(4-nitrophenyl)methanesulfonamide |
| InChIKey | AXEHDVUAWILBRN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)