cas: 137281-08-4 — see every product listed under this CAS number, including other names
N-(4-Oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-yl)pivalamide 97% (CAS 137281-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134558-100mg |
| cas | 137281-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1432.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A134558 |
2,2-dimethyl-N-(4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl)propanamide (CAS 137281-08-4) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: 2,2-dimethyl-N-(4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl)propanamide. InChIKey: LEGZZSRPJRCXSF-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2,2-dimethyl-N-(4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl)propanamide |
| InChIKey | LEGZZSRPJRCXSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC2=C(C=CN2)C(=O)N1 |
Computed by PubChem (NCBI)