CAS 40627-30-3 appears in our catalog under these names: 7–Deaza–2',3'–dideoxyadenosine, 7-Deaza-2',3'-dideoxyadenosine, 7-Deaza-2',3'-dideoxyadenosine, 95%. Offered by: GLPBio, Biosynth, MedChemExpress, Combi-blocks. Available pack sizes: 1g, 20mg, 10mg, 50mg, 250mg, 100mg, Get quote.
[(2S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol (CAS 40627-30-3) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: [(2S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol. InChIKey: IMONOBVOMFRFGW-IONNQARKSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | [(2S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methanol |
| InChIKey | IMONOBVOMFRFGW-IONNQARKSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=CC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)