CAS 1048925-07-0 appears in our catalog under these names: 1'-Ethyl-3',5'-dimethyl-1'h,2h-3,4'-bipyrazole-5-carboxylic acid, 95%, 1'-Ethyl-3',5'-dimethyl-1H,1'H-(3,4'-bipyrazole)-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid (CAS 1048925-07-0) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: 3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: MYUXPJBRMDDBIF-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | MYUXPJBRMDDBIF-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)C2=NNC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)