CAS 1170910-12-9 appears in our catalog under these names: 1,1',3',5'-Tetramethyl-1h,1'h-3,4'-bipyrazole-5-carboxylic acid, 95%, 1,1',3',5'-Tetramethyl-1H,1'H-3,4'-bipyrazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazole-5-carboxylic acid (CAS 1170910-12-9) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: 1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazole-5-carboxylic acid. InChIKey: FKDWPYRTWAUSSM-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazole-5-carboxylic acid |
| InChIKey | FKDWPYRTWAUSSM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C2=NN(C(=C2)C(=O)O)C |
Computed by PubChem (NCBI)