cas: 470463-36-6 — see every product listed under this CAS number, including other names
N-(5-Iodopyridin-2-yl)pivalamide 95+% (CAS 470463-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499160-100mg |
| cas | 470463-36-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1277.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A499160 |
N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide (CAS 470463-36-6) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: APVMIAULAFHJDJ-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | APVMIAULAFHJDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)I |
Computed by PubChem (NCBI)