cas: 470463-36-6 — see every product listed under this CAS number, including other names
N-(5-Iodopyridin-2-yl)pivalamide, 95+%, 95+% (CAS 470463-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1182PL-100mg |
| cas | 470463-36-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 789.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide (CAS 470463-36-6) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: APVMIAULAFHJDJ-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(5-iodo-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | APVMIAULAFHJDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)I |
Computed by PubChem (NCBI)