cas: 13078-13-2 — see every product listed under this CAS number, including other names
N-(M-Tolyl)piperazine diHCl, ≥95%, ≥95% (CAS 13078-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CXK-1g |
| cas | 13078-13-2 |
| size | 1g |
| availability | 70g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 10g | 765.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(3-methylphenyl)piperazine;dihydrochloride (CAS 13078-13-2) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 1-(3-methylphenyl)piperazine;dihydrochloride. InChIKey: QJNWTYUDISMTMR-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 1-(3-methylphenyl)piperazine;dihydrochloride |
| InChIKey | QJNWTYUDISMTMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)