CAS 138227-66-4 is the registry number for 1-(3-Aminophenyl)piperidine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-piperidin-1-ylaniline;dihydrochloride (CAS 138227-66-4) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 3-piperidin-1-ylaniline;dihydrochloride. InChIKey: PSWZSEZMROZLNT-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 3-piperidin-1-ylaniline;dihydrochloride |
| InChIKey | PSWZSEZMROZLNT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)