CAS 6641-28-7 is the registry number for 4-(Piperidin-1-yl)aniline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-piperidin-1-ylaniline;dihydrochloride (CAS 6641-28-7) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 4-piperidin-1-ylaniline;dihydrochloride. InChIKey: HZLBCGZSDLAQOA-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 4-piperidin-1-ylaniline;dihydrochloride |
| InChIKey | HZLBCGZSDLAQOA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)