Products 866954-94-1

CAS 866954-94-1 is the registry number for 4-(Pyrrolidin-1-ylmethyl)aniline dihydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-(pyrrolidin-1-ylmethyl)aniline;dihydrochloride (CAS 866954-94-1) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 4-(pyrrolidin-1-ylmethyl)aniline;dihydrochloride. InChIKey: PZJBIHWTIFYQJY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18Cl2N2
Molecular weight249.18 g/mol
IUPAC name4-(pyrrolidin-1-ylmethyl)aniline;dihydrochloride
InChIKeyPZJBIHWTIFYQJY-UHFFFAOYSA-N
SMILESC1CCN(C1)CC2=CC=C(C=C2)N.Cl.Cl

Computed by PubChem (NCBI)