cas: 1357387-28-0 — see every product listed under this CAS number, including other names
N-(Prop-2-yn-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%, 95% (CAS 1357387-28-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AAVD-100mg |
| cas | 1357387-28-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1854.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1357387-28-0) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BJJVNRNPHMBKSF-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3 |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BJJVNRNPHMBKSF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCC#C |
Computed by PubChem (NCBI)