CAS 2818962-00-2 is the registry number for 6-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2818962-00-2) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: 6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: YEUOVHYVRWWYNQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3 |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | 6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | YEUOVHYVRWWYNQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=C2C=CC=N3)OC |
Computed by PubChem (NCBI)