Products 1201644-36-1

CAS 1201644-36-1 is the registry number for 2-Methoxyquinoline-6-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1201644-36-1) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: DVGWZOHNHYZTKK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20BNO3
Molecular weight285.1 g/mol
IUPAC name2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline
InChIKeyDVGWZOHNHYZTKK-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=C(C=C3)OC

Computed by PubChem (NCBI)