CAS 2377607-98-0 appears in our catalog under these names: 4-Methoxyquinoline-7-boronic acid, pinacol ester, 96%, 4-Methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2377607-98-0) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: GBUVQENTQWYBAT-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3 |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | GBUVQENTQWYBAT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC=CC(=C3C=C2)OC |
Computed by PubChem (NCBI)