cas: 1218790-49-8 — see every product listed under this CAS number, including other names
N-(Prop-2-yn-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1218790-49-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690247-1G |
| cas | 1218790-49-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1700.46 Pln |
| delivery time | 3-4 weeks |
|---|
N-prop-2-ynyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1218790-49-8) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: N-prop-2-ynyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BUZIZNWTLHGQQO-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3 |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | N-prop-2-ynyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BUZIZNWTLHGQQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCC#C |
Computed by PubChem (NCBI)