cas: 41472-49-5 — see every product listed under this CAS number, including other names
N-[2-(4-sulfamoylphenyl)ethyl]acetamide (CAS 41472-49-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718813-100MG |
| cas | 41472-49-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 4126.69 Pln | |
| Fluorochem | 25g | 7776.45 Pln | |
| Fluorochem | 100g | 19345.29 Pln |
| delivery time | 3-4 weeks |
|---|
N-[2-(4-sulfamoylphenyl)ethyl]acetamide (CAS 41472-49-5) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: N-[2-(4-sulfamoylphenyl)ethyl]acetamide. InChIKey: IIMGUEXQORZTID-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| InChIKey | IIMGUEXQORZTID-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)