cas: 62054-72-2 — see every product listed under this CAS number, including other names
N-[2-Nitro-4-(trifluoromethyl)phenyl]morpholine (CAS 62054-72-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008404-1G |
| cas | 62054-72-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 414.46 Pln |
| delivery time | 2-3 weeks |
|---|
4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine (CAS 62054-72-2) is a chemical compound with the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. IUPAC name: 4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine. InChIKey: UNDXPKDBFOOQFC-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O3 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine |
| InChIKey | UNDXPKDBFOOQFC-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)