CAS 1174568-19-4 is the registry number for 1,3,4,5-Tetrahydro-2H-benzo[e][1,4]diazepin-2-one 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid (CAS 1174568-19-4) is a chemical compound with the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. IUPAC name: 1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid. InChIKey: YQSWHFONBRFTHL-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O3 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;2,2,2-trifluoroacetic acid |
| InChIKey | YQSWHFONBRFTHL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2NC(=O)CN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)