Products 223134-72-3
CAS 223134-72-3 appears in our catalog under these names: Flutamide-d7, Flutamide–d7. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
2,3,3,3-tetradeuterio-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide (CAS 223134-72-3) is a chemical compound with the molecular formula C11H11F3N2O3 and a molecular weight of 283.25 g/mol. IUPAC name: 2,3,3,3-tetradeuterio-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide. InChIKey: MKXKFYHWDHIYRV-NWOXSKRJSA-N.
| Molecular formula | C11H11F3N2O3 |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2,3,3,3-tetradeuterio-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide |
| InChIKey | MKXKFYHWDHIYRV-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)