Products 1980040-34-3
CAS 1980040-34-3 is the registry number for 3-(Morpholin-4-yl)-5-(trifluoromethyl)pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1980040-34-3) is a chemical compound with the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. IUPAC name: 3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: PVQNCSCEJUDRSO-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O3 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | PVQNCSCEJUDRSO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(N=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)