cas: 616880-14-9 — see every product listed under this CAS number, including other names
N-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide, 97%, 97% (CAS 616880-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB94-100mg |
| cas | 616880-14-9 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 376.40 Pln | |
| Chemat | 25g | 1149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (CAS 616880-14-9) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide. InChIKey: NPSPNWPZDXQYAC-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4S |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| InChIKey | NPSPNWPZDXQYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NS(=O)(=O)C |
Computed by PubChem (NCBI)