N-4,4-DiF-Pro-OMe·HCl 97%
cas: 156046-05-8 — see every product listed under this CAS number, including other names
N-4,4-DiF-Pro-OMe·HCl 97% (CAS 156046-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A248400-100mg |
| cas | 156046-05-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 25g | 4469.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A248400 |
Methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride (CAS 156046-05-8) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: XGOHSFOAFOLNFY-WCCKRBBISA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | XGOHSFOAFOLNFY-WCCKRBBISA-N |
| SMILES | COC(=O)[C@@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-methyl 4,4-difluoropyrrolidine-2-carboxylate hydrochloride, Methyl (S)-4,4-difluoropyrrolidine-2-carboxylate hydrochloride, methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate hydrochloride, methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride, Methyl (S)-4,4-difluoropyrrolidine-2-carboxylate HCl, XGOHSFOAFOLNFY-WCCKRBBISA-N, N-4,4-DiF-Pro-OMe inverted exclamation mark currencyHCl, (S)-methyl4,4-difluoropyrrolidine-2-carboxylatehydrochloride