cas: 156046-05-8 — see every product listed under this CAS number, including other names
(S)-Methyl 4,4-difluoropyrrolidine-2-carboxylate hydrochloride, 97%, 97% (CAS 156046-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OH1-100mg |
| cas | 156046-05-8 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1187.60 Pln | |
| Chemat | 10g | 2306.00 Pln | |
| Chemat | 25g | 4768.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride (CAS 156046-05-8) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: XGOHSFOAFOLNFY-WCCKRBBISA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | XGOHSFOAFOLNFY-WCCKRBBISA-N |
| SMILES | COC(=O)[C@@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)