cas: 156046-05-8 — see every product listed under this CAS number, including other names
(S)-METHYL 4,4-DIFLUOROPYRROLIDINE-2-CARBOXYLATE HCL, 95% (CAS 156046-05-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F388128-250MG |
| cas | 156046-05-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 3470.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride (CAS 156046-05-8) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: XGOHSFOAFOLNFY-WCCKRBBISA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | XGOHSFOAFOLNFY-WCCKRBBISA-N |
| SMILES | COC(=O)[C@@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)