cas: 438631-75-5 — see every product listed under this CAS number, including other names
N-4-Boc-2-Piperazinecarboxylic acid tert-butyl ester, 95% (CAS 438631-75-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011521-100MG |
| cas | 438631-75-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 325.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ditert-butyl piperazine-1,3-dicarboxylate (CAS 438631-75-5) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl piperazine-1,3-dicarboxylate. InChIKey: NCDRUHJVDHVOAF-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl piperazine-1,3-dicarboxylate |
| InChIKey | NCDRUHJVDHVOAF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CN(CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)