CAS 2089389-11-5 is the registry number for Di-tert-butyl (S)-piperazine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (3S)-piperazine-1,3-dicarboxylate (CAS 2089389-11-5) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl (3S)-piperazine-1,3-dicarboxylate. InChIKey: NCDRUHJVDHVOAF-JTQLQIEISA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl (3S)-piperazine-1,3-dicarboxylate |
| InChIKey | NCDRUHJVDHVOAF-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)