cas: 1946-82-3 — see every product listed under this CAS number, including other names
N-Acetyl-L-lysine, 98%, 98% (CAS 1946-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143GR-250mg |
| cas | 1946-82-3 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 515.60 Pln | |
| Chemat | 100g | 1696.40 Pln | |
| Chemat | 500g | 6667.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N(2)-acetyl-L-lysine is an acetyl-L-lysine where the acetyl group is located at the N2-posiiton. It has a role as a human metabolite. It is a tautomer of a N(2)-acetyl-L-lysine zwitterion.
Source: ChEBI
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-acetamido-6-aminohexanoic acid |
| InChIKey | VEYYWZRYIYDQJM-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)