cas: 3005-61-6 — see every product listed under this CAS number, including other names
N-Benzoyl-L-Phenylalanine methyl ester, 98%, 98% (CAS 3005-61-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJ3Z-5g |
| cas | 3005-61-6 |
| size | 5g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 117.20 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 597.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-benzamido-3-phenylpropanoate (CAS 3005-61-6) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: methyl (2S)-2-benzamido-3-phenylpropanoate. InChIKey: BRQQPHKRRCUYLA-HNNXBMFYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | methyl (2S)-2-benzamido-3-phenylpropanoate |
| InChIKey | BRQQPHKRRCUYLA-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)