N-Benzyl-3,4-dimethoxyaniline, 97%
cas: 39217-14-6 — see every product listed under this CAS number, including other names
N-Benzyl-3,4-dimethoxyaniline, 97% (CAS 39217-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A218771-100mg |
| cas | 39217-14-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1730.00 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1108.52 Pln | |
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1398.48 Pln | |
| Fluorochem | 1g | 3225.97 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
N-benzyl-3,4-dimethoxyaniline (CAS 39217-14-6) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: N-benzyl-3,4-dimethoxyaniline. InChIKey: ISFAKKYTEKYAMC-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | N-benzyl-3,4-dimethoxyaniline |
| InChIKey | ISFAKKYTEKYAMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NCC2=CC=CC=C2)OC |
Computed by PubChem (NCBI)