CAS 29974-49-0 appears in our catalog under these names: 2-(Anilinomethylene)-5,5-dimethylcyclohexane-1,3-dione, 95%, 5,5-Dimethyl-2-((phenylamino)methylidene)cyclohexane-1,3-dione, 90%, 5,5-Dimethyl-2-((phenylamino)methylidene)cyclohexane-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 25mg, 100mg, 250mg.
3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one (CAS 29974-49-0) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one. InChIKey: WUDXQKBKKYVSNS-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one |
| InChIKey | WUDXQKBKKYVSNS-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C=NC2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)