Products 39217-14-6
CAS 39217-14-6 appears in our catalog under these names: N-Benzyl-3,4-dimethoxyaniline, 95%, N-Benzyl-3,4-dimethoxyaniline, 95-<97%, N-Benzyl-3,4-dimethoxyaniline, ≥97-<99%, N-Benzyl-3,4-dimethoxyaniline, N-Benzyl-3,4-dimethoxyaniline, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 50g, 100g.
N-benzyl-3,4-dimethoxyaniline (CAS 39217-14-6) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: N-benzyl-3,4-dimethoxyaniline. InChIKey: ISFAKKYTEKYAMC-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | N-benzyl-3,4-dimethoxyaniline |
| InChIKey | ISFAKKYTEKYAMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NCC2=CC=CC=C2)OC |
Computed by PubChem (NCBI)