CAS 892874-87-2 is the registry number for Ethyl 2,6,7-trimethylquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2,6,7-trimethylquinoline-3-carboxylate (CAS 892874-87-2) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: ethyl 2,6,7-trimethylquinoline-3-carboxylate. InChIKey: PKWJEOYUFQXCBY-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | ethyl 2,6,7-trimethylquinoline-3-carboxylate |
| InChIKey | PKWJEOYUFQXCBY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=C(C(=CC2=C1)C)C)C |
Computed by PubChem (NCBI)