cas: 1956341-96-0 — see every product listed under this CAS number, including other names
N-Benzyloxetan-3-amine oxalate 95% (CAS 1956341-96-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194636-100mg |
| cas | 1956341-96-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A194636 |
N-benzyloxetan-3-amine;oxalic acid (CAS 1956341-96-0) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: N-benzyloxetan-3-amine;oxalic acid. InChIKey: FXVRJNNUVWIRMZ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | N-benzyloxetan-3-amine;oxalic acid |
| InChIKey | FXVRJNNUVWIRMZ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)NCC2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)