CAS 1219446-76-0 is the registry number for (R)-2-((2,2-Dimethyl-1,3-dioxolan-4-yl)methoxy)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-3-carboxylic acid (CAS 1219446-76-0) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-3-carboxylic acid. InChIKey: FKRCGPLCZBPVIA-MRVPVSSYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-3-carboxylic acid |
| InChIKey | FKRCGPLCZBPVIA-MRVPVSSYSA-N |
| SMILES | CC1(OC[C@H](O1)COC2=C(C=CC=N2)C(=O)O)C |
Computed by PubChem (NCBI)