CAS 20768-14-3 appears in our catalog under these names: tert-Butyl 2-(4-nitrophenoxy)acetate, 98%, tert-butyl 4-nitrophenoxyacetate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g.
Tert-butyl 2-(4-nitrophenoxy)acetate (CAS 20768-14-3) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: tert-butyl 2-(4-nitrophenoxy)acetate. InChIKey: ASMSZGIOBJIOLQ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | tert-butyl 2-(4-nitrophenoxy)acetate |
| InChIKey | ASMSZGIOBJIOLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)