CAS 1956341-96-0 appears in our catalog under these names: N-Benzyloxetan-3-amine oxalate, 95%, N–Benzyloxetan–3–amine oxalate, N-Benzyloxetan-3-amine oxalate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
N-benzyloxetan-3-amine;oxalic acid (CAS 1956341-96-0) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: N-benzyloxetan-3-amine;oxalic acid. InChIKey: FXVRJNNUVWIRMZ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | N-benzyloxetan-3-amine;oxalic acid |
| InChIKey | FXVRJNNUVWIRMZ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)NCC2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)