cas: 79069-15-1 — see every product listed under this CAS number, including other names
N-Boc-(S)-2-amino-3-benzyloxy-1-propanol, 98%, 98% (CAS 79069-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119N39-100mg |
| cas | 79069-15-1 |
| size | 100mg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1163.60 Pln | |
| Chemat | 100g | 1854.80 Pln | |
| Chemat | 1kg | 10509.20 Pln | |
| Chemat | 5kg | 49200.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate (CAS 79069-15-1) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate. InChIKey: MSIDLARYVJJEQY-ZDUSSCGKSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate |
| InChIKey | MSIDLARYVJJEQY-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)