cas: 79069-15-1 — see every product listed under this CAS number, including other names
Boc-Serinol(Bzl) (CAS 79069-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06281-100MG |
| cas | 79069-15-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1325.59 Pln | |
| Fluorochem | 10g | 2471.02 Pln | |
| Fluorochem | 25g | 5558.48 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate (CAS 79069-15-1) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate. InChIKey: MSIDLARYVJJEQY-ZDUSSCGKSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate |
| InChIKey | MSIDLARYVJJEQY-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)