cas: 479622-36-1 — see every product listed under this CAS number, including other names
N-Boc-3-Iodomethyl-pyrrolidine, 95% (CAS 479622-36-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048624-100MG |
| cas | 479622-36-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 950.72 Pln | |
| Fluorochem | 10g | 1736.91 Pln | |
| Fluorochem | 25g | 3538.36 Pln | |
| Fluorochem | 100g | 13998.21 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 479622-36-1) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-UHFFFAOYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CI |
Computed by PubChem (NCBI)