cas: 850761-36-3 — see every product listed under this CAS number, including other names
N-Boc-3-Iodopiperidine, 97% (CAS 850761-36-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077418-250MG |
| cas | 850761-36-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-iodopiperidine-1-carboxylate (CAS 850761-36-3) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl 3-iodopiperidine-1-carboxylate. InChIKey: JXEZFSNOYBRXFT-UHFFFAOYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl 3-iodopiperidine-1-carboxylate |
| InChIKey | JXEZFSNOYBRXFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)I |
Computed by PubChem (NCBI)