N-Boc-3-bromo-6-chloroindole, 97%
cas: 1246471-36-2 — see every product listed under this CAS number, including other names
N-Boc-3-bromo-6-chloroindole, 97% (CAS 1246471-36-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A897576-250mg |
| cas | 1246471-36-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 10g | 1049.00 Pln | |
| Ambeed | 25g | 2028.00 Pln | |
| Ambeed | 100g | 6644.88 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1080.89 Pln | |
| Fluorochem | 25g | 2085.74 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 264.38 Pln | |
| BLDpharm | 5g | 669.79 Pln | |
| BLDpharm | 10g | 1125.18 Pln | |
| BLDpharm | 25g | 2180.37 Pln | |
| BLDpharm | 100g | 7156.39 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-bromo-6-chloroindole-1-carboxylate (CAS 1246471-36-2) is a chemical compound with the molecular formula C13H13BrClNO2 and a molecular weight of 330.60 g/mol. IUPAC name: tert-butyl 3-bromo-6-chloroindole-1-carboxylate. InChIKey: BZZPVBVOSNRGHB-UHFFFAOYSA-N.
| Molecular formula | C13H13BrClNO2 |
|---|---|
| Molecular weight | 330.60 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-chloroindole-1-carboxylate |
| InChIKey | BZZPVBVOSNRGHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
N-Boc-3-bromo-6-chloroindole, 3-bromo-6-chloro-1h-indole-1-carboxylic acid tert-butyl ester, 1H-Indole-1-carboxylic acid, 3-bromo-6-chloro-, 1,1-dimethylethyl ester, tert-butyl 3-bromo-6-chloro-indole-1-carboxylate, tert-butyl 3-bromo-6-chloro-1H-indole-1-carboxylate, 1,1-Dimethylethyl 3-bromo-6-chloro-1H-indole-1-carboxylate