CAS 332012-24-5 appears in our catalog under these names: (R)-(-)-Bromo Dragonfly Hydrochloride, >95% (HPLC), (R)-(-)-Bromo dragonfly hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg.
(2R)-1-(4-bromofuro[2,3-f][1]benzofuran-8-yl)propan-2-amine;hydrochloride (CAS 332012-24-5) is a chemical compound with the molecular formula C13H13BrClNO2 and a molecular weight of 330.60 g/mol. IUPAC name: (2R)-1-(4-bromofuro[2,3-f][1]benzofuran-8-yl)propan-2-amine;hydrochloride. InChIKey: YDIDKNSMQNPNFC-OGFXRTJISA-N.
| Molecular formula | C13H13BrClNO2 |
|---|---|
| Molecular weight | 330.60 g/mol |
| IUPAC name | (2R)-1-(4-bromofuro[2,3-f][1]benzofuran-8-yl)propan-2-amine;hydrochloride |
| InChIKey | YDIDKNSMQNPNFC-OGFXRTJISA-N |
| SMILES | C[C@H](CC1=C2C=COC2=C(C3=C1OC=C3)Br)N.Cl |
Computed by PubChem (NCBI)