Products 1191028-42-8
CAS 1191028-42-8 is the registry number for TERT-BUTYL 4-BROMO-5-CHLORO-1H-INDOLE-1-CARBOXYLATE, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.
Tert-butyl 4-bromo-5-chloroindole-1-carboxylate (CAS 1191028-42-8) is a chemical compound with the molecular formula C13H13BrClNO2 and a molecular weight of 330.60 g/mol. IUPAC name: tert-butyl 4-bromo-5-chloroindole-1-carboxylate. InChIKey: RZIIXNBVUXFULC-UHFFFAOYSA-N.
| Molecular formula | C13H13BrClNO2 |
|---|---|
| Molecular weight | 330.60 g/mol |
| IUPAC name | tert-butyl 4-bromo-5-chloroindole-1-carboxylate |
| InChIKey | RZIIXNBVUXFULC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2Br)Cl |
Computed by PubChem (NCBI)