CAS 2168508-45-8 is the registry number for tert-Butyl 6-bromo-4-chloro-1H-indole-1-carboxylate. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Tert-butyl 6-bromo-4-chloroindole-1-carboxylate (CAS 2168508-45-8) is a chemical compound with the molecular formula C13H13BrClNO2 and a molecular weight of 330.60 g/mol. IUPAC name: tert-butyl 6-bromo-4-chloroindole-1-carboxylate. InChIKey: TUEUBBUSPRFZDS-UHFFFAOYSA-N.
| Molecular formula | C13H13BrClNO2 |
|---|---|
| Molecular weight | 330.60 g/mol |
| IUPAC name | tert-butyl 6-bromo-4-chloroindole-1-carboxylate |
| InChIKey | TUEUBBUSPRFZDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)