cas: 158985-25-2 — see every product listed under this CAS number, including other names
N-Boc-4-(4-Hydroxyphenyl)piperazine, 97% (CAS 158985-25-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048623-1G |
| cas | 158985-25-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 825.77 Pln | |
| Fluorochem | 50g | 1424.52 Pln | |
| Fluorochem | 100g | 2569.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate (CAS 158985-25-2) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate. InChIKey: YEHWSWXESXPBOS-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate |
| InChIKey | YEHWSWXESXPBOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)