cas: 158985-25-2 — see every product listed under this CAS number, including other names
tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate, 97%, 97% (CAS 158985-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112R3Z-250mg |
| cas | 158985-25-2 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 645.20 Pln | |
| Chemat | 50g | 1158.80 Pln | |
| Chemat | 100g | 2166.80 Pln | |
| Chemat | 500g | 8548.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate (CAS 158985-25-2) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate. InChIKey: YEHWSWXESXPBOS-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate |
| InChIKey | YEHWSWXESXPBOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)