cas: 290331-71-4 — see every product listed under this CAS number, including other names
N-Boc-5-Methoxyindole-2-boronic acid, 95% (CAS 290331-71-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225045-100MG |
| cas | 290331-71-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Fluorochem | 10g | 752.88 Pln | |
| Fluorochem | 25g | 1788.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 290331-71-4) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: PZLVPMBCKHDVKT-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | PZLVPMBCKHDVKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)OC)(O)O |
Computed by PubChem (NCBI)