N-Boc-Iminodipropionic Acid, 97%, 97%
cas: 143766-89-6 — see every product listed under this CAS number, including other names
N-Boc-Iminodipropionic Acid, 97%, 97% (CAS 143766-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IC5-100mg |
| cas | 143766-89-6 |
| size | 100mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2406.80 Pln | |
| Chemat | 100g | 7562.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 143766-89-6) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: NIFJJASPEGEHDS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | NIFJJASPEGEHDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-{[(Tert-butoxy)carbonyl](2-carboxyethyl)amino}propanoic acid, 3-(((tert-butoxy)carbonyl)(2-carboxyethyl)amino)propanoic acid, N-Boc-iminodipropionic acid, Boc-iminodipropionic acid, 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid, beta-Alanine, N-(2-carboxyethyl)-N-[(1,1-dimethylethoxy)carbonyl]-, 3-[tert-butoxycarbonyl(2-carboxyethyl)amino]propanoic acid, N-Boc-iminodipropionicacid, N-Boc-3,3'-azanediyldipropionic acid, N-Boc-iminodipropionic acid, >=97.0% (HPLC)