Products 1185301-26-1

CAS 1185301-26-1 is the registry number for 3-((tert-Butoxycarbonyl)amino)hexanedioic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 1185301-26-1) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: BWZYMMYMEYGJOL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO6
Molecular weight261.27 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid
InChIKeyBWZYMMYMEYGJOL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCC(=O)O)CC(=O)O

Computed by PubChem (NCBI)